C31H44N4O6 — CID 44563394
(3S,9S,12R)-3-benzyl-9-[(7S)-7-hydroxy-6-oxooctyl]spiro[1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-6,1'-cyclohexane]-2,5,8,11-tetrone (PubChem CID 44563394) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is (3S,9S,12R)-3-benzyl-9-[(7S)-7-hydroxy-6-oxooctyl]spiro[1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-6,1'-cyclohexane]-2,5,8,11-tetrone.
| Compound Name | (3S,9S,12R)-3-benzyl-9-[(7S)-7-hydroxy-6-oxooctyl]spiro[1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-6,1'-cyclohexane]-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 44563394 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | (3S,9S,12R)-3-benzyl-9-[(7S)-7-hydroxy-6-oxooctyl]spiro[1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-6,1'-cyclohexane]-2,5,8,11-tetrone |
| SMILES | C[C@H](O)C(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)C2(CCCCC2)NC1=O |
| InChI | InChI=1S/C31H44N4O6/c1-21(36)26(37)16-8-3-7-14-23-27(38)34-31(17-9-4-10-18-31)30(41)33-24(20-22-12-5-2-6-13-22)29(40)35-19-11-15-25(35)28(39)32-23/h2,5-6,12-13,21,23-25,36H,3-4,7-11,14-20H2,1H3,(H,32,39)(H,33,41)(H,34,38)/t21-,23-,24-,25+/m0/s1 |
| InChIKey | CJANBLJYNHLFGY-BELIEFIBSA-N |
| XLogP | 1.92 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|