C23H22Cl4N2O2 — CID 44563396
(Z)-3-(3,4-dichlorophenyl)-N-[5-[[(Z)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]prop-2-enamide (PubChem CID 44563396) has the molecular formula C23H22Cl4N2O2 and a molecular weight of 500.25 g/mol. Its IUPAC name is (Z)-3-(3,4-dichlorophenyl)-N-[5-[[(Z)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]prop-2-enamide.
| Compound Name | (Z)-3-(3,4-dichlorophenyl)-N-[5-[[(Z)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44563396 |
| Molecular Formula | C23H22Cl4N2O2 |
| Molecular Weight | 500.25 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | (Z)-3-(3,4-dichlorophenyl)-N-[5-[[(Z)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C\c1ccc(Cl)c(Cl)c1)NCCCCCNC(=O)/C=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H22Cl4N2O2/c24-18-8-4-16(14-20(18)26)6-10-22(30)28-12-2-1-3-13-29-23(31)11-7-17-5-9-19(25)21(27)15-17/h4-11,14-15H,1-3,12-13H2,(H,28,30)(H,29,31)/b10-6-,11-7- |
| InChIKey | PZSIAABVIUXCSZ-SQXCDDPUSA-N |
| XLogP | 6.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.25 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|