C26H35NO7 — CID 44563520
4-[(E,5S)-5-[(2R,3Z,5R,6S,7S,8E,12E)-6,7-dihydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohex-2-enyl]piperidine-2,6-dione (PubChem CID 44563520) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is 4-[(E,5S)-5-[(2R,3Z,5R,6S,7S,8E,12E)-6,7-dihydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohex-2-enyl]piperidine-2,6-dione.
| Compound Name | 4-[(E,5S)-5-[(2R,3Z,5R,6S,7S,8E,12E)-6,7-dihydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohex-2-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 44563520 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 4-[(E,5S)-5-[(2R,3Z,5R,6S,7S,8E,12E)-6,7-dihydroxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohex-2-enyl]piperidine-2,6-dione |
| SMILES | C/C1=C/[C@@H](C)[C@H](O)[C@@H](O)/C=C/CC/C=C/C(=O)O[C@@H]1[C@H](C)C(=O)/C=C/CC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C26H35NO7/c1-16-13-17(2)26(34-24(32)12-7-5-4-6-10-21(29)25(16)33)18(3)20(28)11-8-9-19-14-22(30)27-23(31)15-19/h6-8,10-13,16,18-19,21,25-26,29,33H,4-5,9,14-15H2,1-3H3,(H,27,30,31)/b10-6+,11-8+,12-7+,17-13-/t16-,18-,21+,25+,26+/m1/s1 |
| InChIKey | WZBJCRHBCKMTQP-WULNYKMUSA-N |
| XLogP | 2.31 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|