C27H39NO8 — CID 44563521
4-[(2R,5S)-2-hydroxy-5-[(2R,3Z,5R,6S,7S,8E,12E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione (PubChem CID 44563521) has the molecular formula C27H39NO8 and a molecular weight of 505.61 g/mol. Its IUPAC name is 4-[(2R,5S)-2-hydroxy-5-[(2R,3Z,5R,6S,7S,8E,12E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione.
| Compound Name | 4-[(2R,5S)-2-hydroxy-5-[(2R,3Z,5R,6S,7S,8E,12E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 44563521 |
| Molecular Formula | C27H39NO8 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 4-[(2R,5S)-2-hydroxy-5-[(2R,3Z,5R,6S,7S,8E,12E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-4-oxohexyl]piperidine-2,6-dione |
| SMILES | CO[C@H]1/C=C/CC/C=C/C(=O)O[C@H]([C@H](C)C(=O)C[C@H](O)CC2CC(=O)NC(=O)C2)/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H39NO8/c1-16-11-17(2)27(36-25(33)10-8-6-5-7-9-22(35-4)26(16)34)18(3)21(30)15-20(29)12-19-13-23(31)28-24(32)14-19/h7-11,16,18-20,22,26-27,29,34H,5-6,12-15H2,1-4H3,(H,28,31,32)/b9-7+,10-8+,17-11-/t16-,18-,20-,22+,26+,27+/m1/s1 |
| InChIKey | NHJYIURPTCADHA-KNZWQXTDSA-N |
| XLogP | 2.16 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|