C14H13NO2 — CID 44563530
4,8,9-trimethyl-1H-furo[2,3-h]quinolin-2-one (PubChem CID 44563530) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4,8,9-trimethyl-1H-furo[2,3-h]quinolin-2-one.
| Compound Name | 4,8,9-trimethyl-1H-furo[2,3-h]quinolin-2-one |
|---|---|
| PubChem CID | 44563530 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4,8,9-trimethyl-1H-furo[2,3-h]quinolin-2-one |
| SMILES | Cc1oc2ccc3c(C)cc(=O)[nH]c3c2c1C |
| InChI | InChI=1S/C14H13NO2/c1-7-6-12(16)15-14-10(7)4-5-11-13(14)8(2)9(3)17-11/h4-6H,1-3H3,(H,15,16) |
| InChIKey | OREZZBPRDDFVTE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |