C26H37NO6 — CID 44563545
4-[(2R,5S)-5-[(2R,3Z,5S,8E,12E)-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-2-hydroxy-4-oxohexyl]piperidine-2,6-dione (PubChem CID 44563545) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is 4-[(2R,5S)-5-[(2R,3Z,5S,8E,12E)-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-2-hydroxy-4-oxohexyl]piperidine-2,6-dione.
| Compound Name | 4-[(2R,5S)-5-[(2R,3Z,5S,8E,12E)-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-2-hydroxy-4-oxohexyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 44563545 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-[(2R,5S)-5-[(2R,3Z,5S,8E,12E)-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8,12-trien-2-yl]-2-hydroxy-4-oxohexyl]piperidine-2,6-dione |
| SMILES | C/C1=C/[C@@H](C)CC/C=C/CC/C=C/C(=O)O[C@@H]1[C@H](C)C(=O)C[C@H](O)CC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C26H37NO6/c1-17-10-8-6-4-5-7-9-11-25(32)33-26(18(2)12-17)19(3)22(29)16-21(28)13-20-14-23(30)27-24(31)15-20/h4,6,9,11-12,17,19-21,26,28H,5,7-8,10,13-16H2,1-3H3,(H,27,30,31)/b6-4+,11-9+,18-12-/t17-,19+,21+,26-/m0/s1 |
| InChIKey | RRUGEVGSYUICHY-NJHWWSOLSA-N |
| XLogP | 3.57 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|