C24H24N2O4 — CID 44563594
2-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaen-21-yl)-N,N-dimethylethanamine (PubChem CID 44563594) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaen-21-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaen-21-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 44563594 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(21),2,4(8),9,11,13,15,17,19-nonaen-21-yl)-N,N-dimethylethanamine |
| SMILES | COc1cc2cc(CCN(C)C)c3c4cc5c(cc4ncc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C24H24N2O4/c1-26(2)6-5-14-7-15-8-20(27-3)21(28-4)9-16(15)18-12-25-19-11-23-22(29-13-30-23)10-17(19)24(14)18/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | AQQKURMSZKXWGP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|