C33H33NO3 — CID 44563616
methyl (2R)-3-phenyl-2-(5,5,5-triphenylpentanoylamino)propanoate (PubChem CID 44563616) has the molecular formula C33H33NO3 and a molecular weight of 491.63 g/mol. Its IUPAC name is methyl (2R)-3-phenyl-2-(5,5,5-triphenylpentanoylamino)propanoate.
| Compound Name | methyl (2R)-3-phenyl-2-(5,5,5-triphenylpentanoylamino)propanoate |
|---|---|
| PubChem CID | 44563616 |
| Molecular Formula | C33H33NO3 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | methyl (2R)-3-phenyl-2-(5,5,5-triphenylpentanoylamino)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)CCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H33NO3/c1-37-32(36)30(25-26-15-6-2-7-16-26)34-31(35)23-14-24-33(27-17-8-3-9-18-27,28-19-10-4-11-20-28)29-21-12-5-13-22-29/h2-13,15-22,30H,14,23-25H2,1H3,(H,34,35)/t30-/m1/s1 |
| InChIKey | UZFLTJRVRHNPPD-SSEXGKCCSA-N |
| XLogP | 6.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|