C26H37NO2 — CID 44563659
(5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-17-phenylheptadeca-5,8,11,14-tetraenamide (PubChem CID 44563659) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-17-phenylheptadeca-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-17-phenylheptadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 44563659 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-17-phenylheptadeca-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCc1ccccc1 |
| InChI | InChI=1S/C26H37NO2/c1-24(23-28)27-26(29)22-18-13-11-9-7-5-3-2-4-6-8-10-12-15-19-25-20-16-14-17-21-25/h3-6,9-12,14,16-17,20-21,24,28H,2,7-8,13,15,18-19,22-23H2,1H3,(H,27,29)/b5-3-,6-4-,11-9-,12-10-/t24-/m1/s1 |
| InChIKey | CUSGYEPXHCHJLA-ADWDLVTFSA-N |
| XLogP | 5.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|