C27H39NO2 — CID 44563677
(5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-18-phenyloctadeca-5,8,11,14-tetraenamide (PubChem CID 44563677) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-18-phenyloctadeca-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-18-phenyloctadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 44563677 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-18-phenyloctadeca-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCc1ccccc1 |
| InChI | InChI=1S/C27H39NO2/c1-25(24-29)28-27(30)23-19-14-12-10-8-6-4-2-3-5-7-9-11-13-16-20-26-21-17-15-18-22-26/h3-6,9-12,15,17-18,21-22,25,29H,2,7-8,13-14,16,19-20,23-24H2,1H3,(H,28,30)/b5-3-,6-4-,11-9-,12-10-/t25-/m1/s1 |
| InChIKey | OJYRRPROJHHDIB-GPRMDNKHSA-N |
| XLogP | 6.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|