2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid

C15H11Cl2NO4 — CID 44563691

IUPAC2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid
SMILESO=C(O)CN(C(=O)c1ccccc1O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C15H11Cl2NO4/c16-9-5-10(17)7-11(6-9)18(8-14(20)21)15(22)12-3-1-2-4-13(12)19/h1-7,19H,8H2,(H,20,21)
InChIKeyDACIPZZDIBGJCJ-UHFFFAOYSA-N
MW340.16 g/mol
LogP3.43
Rot. Bonds4

About 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid

2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid (PubChem CID 44563691) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid.

Molecular Properties

Compound Name2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid
PubChem CID44563691
Molecular FormulaC15H11Cl2NO4
Molecular Weight340.16 g/mol
Exact Mass339.01
IUPAC Name2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid
SMILESO=C(O)CN(C(=O)c1ccccc1O)c1cc(Cl)cc(Cl)c1
InChIInChI=1S/C15H11Cl2NO4/c16-9-5-10(17)7-11(6-9)18(8-14(20)21)15(22)12-3-1-2-4-13(12)19/h1-7,19H,8H2,(H,20,21)
InChIKeyDACIPZZDIBGJCJ-UHFFFAOYSA-N
XLogP3.43
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.16
LogP ≤ 53.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid?
The IUPAC name of 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid (CID 44563691) is 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid.
What is the SMILES notation for 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid?
The canonical SMILES for 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid is O=C(O)CN(C(=O)c1ccccc1O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid?
The InChIKey is DACIPZZDIBGJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO4/c16-9-5-10(17)7-11(6-9)18(8-14(20)21)15(22)12-3-1-2-4-13(12)19/h1-7,19H,8H2,(H,20,21).
What are the key properties of 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid?
2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid has a molecular weight of 340.16 g/mol, XLogP of 3.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichloro-N-(2-hydroxybenzoyl)anilino)acetic acid is sourced from PubChem (CID 44563691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).