About 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol
5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 44563762) has the molecular formula C16H16O4
and a molecular weight of 272.30 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol |
| PubChem CID | 44563762 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | COc1ccc(/C=C/c2cc(O)cc(O)c2)cc1OC |
| InChI | InChI=1S/C16H16O4/c1-19-15-6-5-11(9-16(15)20-2)3-4-12-7-13(17)10-14(18)8-12/h3-10,17-18H,1-2H3/b4-3+ |
| InChIKey | WHKSEHKYYXHCTA-ONEGZZNKSA-N |
| XLogP | 3.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol?
The IUPAC name of 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol (CID 44563762) is 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol.
What is the SMILES notation for 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol?
The canonical SMILES for 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol is COc1ccc(/C=C/c2cc(O)cc(O)c2)cc1OC.
What is the InChIKey of 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol?
The InChIKey is WHKSEHKYYXHCTA-ONEGZZNKSA-N. The full InChI is InChI=1S/C16H16O4/c1-19-15-6-5-11(9-16(15)20-2)3-4-12-7-13(17)10-14(18)8-12/h3-10,17-18H,1-2H3/b4-3+.
What are the key properties of 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol?
5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol has a molecular weight of 272.30 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol is sourced from PubChem (CID 44563762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).