C17H16N2 — CID 44563824
2,3-diphenyl-6,7-dihydro-5H-1,4-diazepine (PubChem CID 44563824) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,3-diphenyl-6,7-dihydro-5H-1,4-diazepine.
| Compound Name | 2,3-diphenyl-6,7-dihydro-5H-1,4-diazepine |
|---|---|
| PubChem CID | 44563824 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2,3-diphenyl-6,7-dihydro-5H-1,4-diazepine |
| SMILES | c1ccc(C2=NCCCN=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2/c1-3-8-14(9-4-1)16-17(19-13-7-12-18-16)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | DVCLKCMPVIKESN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |