About 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine
2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine (PubChem CID 44563840) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine.
Molecular Properties
| Compound Name | 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine |
| PubChem CID | 44563840 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine |
| SMILES | CSc1ccc(C2=NCCCN=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N2S/c1-21-16-10-8-15(9-11-16)18-17(19-12-5-13-20-18)14-6-3-2-4-7-14/h2-4,6-11H,5,12-13H2,1H3 |
| InChIKey | JFGJPOHNORNWNH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine?
The IUPAC name of 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine (CID 44563840) is 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine.
What is the SMILES notation for 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine?
The canonical SMILES for 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine is CSc1ccc(C2=NCCCN=C2c2ccccc2)cc1.
What is the InChIKey of 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine?
The InChIKey is JFGJPOHNORNWNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2S/c1-21-16-10-8-15(9-11-16)18-17(19-12-5-13-20-18)14-6-3-2-4-7-14/h2-4,6-11H,5,12-13H2,1H3.
What are the key properties of 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine?
2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine has a molecular weight of 294.42 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylsulfanylphenyl)-3-phenyl-6,7-dihydro-5H-1,4-diazepine is sourced from PubChem (CID 44563840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).