C20H34O7 — CID 44563911
propan-2-yl (E,4R)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-4-hydroxy-3-methylbut-2-enoate (PubChem CID 44563911) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is propan-2-yl (E,4R)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-4-hydroxy-3-methylbut-2-enoate.
| Compound Name | propan-2-yl (E,4R)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-4-hydroxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 44563911 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | propan-2-yl (E,4R)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-4-hydroxy-3-methylbut-2-enoate |
| SMILES | C/C(=C\C(=O)OC(C)C)[C@@H](O)[C@@H]1OC[C@H](C/C=C/[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H34O7/c1-11(2)27-16(22)9-13(4)17(23)20-19(25)18(24)15(10-26-20)8-6-7-12(3)14(5)21/h6-7,9,11-12,14-15,17-21,23-25H,8,10H2,1-5H3/b7-6+,13-9+/t12-,14+,15+,17-,18-,19-,20+/m1/s1 |
| InChIKey | BCIGZAGSJJJJSK-ZNEQUWIYSA-N |
| XLogP | 0.95 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|