C12H20O6 — CID 44563935
ethyl (E,4R)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate (PubChem CID 44563935) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 44563935 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | ethyl (E,4R)-4-[(2S,3R,4R)-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)[C@@H](O)[C@@H]1OCC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H20O6/c1-3-17-9(14)6-7(2)10(15)12-11(16)8(13)4-5-18-12/h6,8,10-13,15-16H,3-5H2,1-2H3/b7-6+/t8-,10-,11-,12+/m1/s1 |
| InChIKey | OLALOFIBLOHJBL-FYXIHVDISA-N |
| XLogP | -0.63 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|