C18H32O6 — CID 44563938
ethyl (E,4R)-4-[(2S,3R,4R,5S)-5-hexyl-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate (PubChem CID 44563938) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(2S,3R,4R,5S)-5-hexyl-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(2S,3R,4R,5S)-5-hexyl-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 44563938 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | ethyl (E,4R)-4-[(2S,3R,4R,5S)-5-hexyl-3,4-dihydroxyoxan-2-yl]-4-hydroxy-3-methylbut-2-enoate |
| SMILES | CCCCCC[C@H]1CO[C@@H]([C@H](O)/C(C)=C/C(=O)OCC)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32O6/c1-4-6-7-8-9-13-11-24-18(17(22)16(13)21)15(20)12(3)10-14(19)23-5-2/h10,13,15-18,20-22H,4-9,11H2,1-3H3/b12-10+/t13-,15+,16+,17+,18-/m0/s1 |
| InChIKey | NMPWBXRUHJXSDQ-VPYNLIENSA-N |
| XLogP | 1.56 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|