C14H20O6 — CID 44564017
ethyl (3E,3aS,4R,7R,7aR)-3a,7-dihydroxy-3-(2-hydroxyethylidene)-6-methyl-7,7a-dihydro-4H-1-benzofuran-4-carboxylate (PubChem CID 44564017) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl (3E,3aS,4R,7R,7aR)-3a,7-dihydroxy-3-(2-hydroxyethylidene)-6-methyl-7,7a-dihydro-4H-1-benzofuran-4-carboxylate.
| Compound Name | ethyl (3E,3aS,4R,7R,7aR)-3a,7-dihydroxy-3-(2-hydroxyethylidene)-6-methyl-7,7a-dihydro-4H-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 44564017 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl (3E,3aS,4R,7R,7aR)-3a,7-dihydroxy-3-(2-hydroxyethylidene)-6-methyl-7,7a-dihydro-4H-1-benzofuran-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C(C)[C@@H](O)[C@H]2OC/C(=C\CO)[C@]21O |
| InChI | InChI=1S/C14H20O6/c1-3-19-13(17)10-6-8(2)11(16)12-14(10,18)9(4-5-15)7-20-12/h4,6,10-12,15-16,18H,3,5,7H2,1-2H3/b9-4+/t10-,11+,12+,14+/m0/s1 |
| InChIKey | RXFMLZFQXNVZJG-POBGHTJOSA-N |
| XLogP | -0.46 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|