C31H28N2O2 — CID 44564314
methyl 4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 44564314) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is methyl 4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl 4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 44564314 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | methyl 4-anilino-1,2,6-triphenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccccc2)CC(c2ccccc2)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C31H28N2O2/c1-35-31(34)29-27(32-25-18-10-4-11-19-25)22-28(23-14-6-2-7-15-23)33(26-20-12-5-13-21-26)30(29)24-16-8-3-9-17-24/h2-21,28,30,32H,22H2,1H3 |
| InChIKey | VJWVYCGBFCLUBC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |