C9H14N3O9P — CID 44564410
5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrazole-4-carboxylic acid (PubChem CID 44564410) has the molecular formula C9H14N3O9P and a molecular weight of 339.20 g/mol. Its IUPAC name is 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 44564410 |
| Molecular Formula | C9H14N3O9P |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyrazole-4-carboxylic acid |
| SMILES | Nc1c(C(=O)O)cnn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14N3O9P/c10-7-3(9(15)16)1-11-12(7)8-6(14)5(13)4(21-8)2-20-22(17,18)19/h1,4-6,8,13-14H,2,10H2,(H,15,16)(H2,17,18,19)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | YYTUFDZEDTZIRC-UAKXSSHOSA-N |
| XLogP | -2.11 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|