About methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate
methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate (PubChem CID 44564469) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate.
Molecular Properties
| Compound Name | methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate |
| PubChem CID | 44564469 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate |
| SMILES | COC(=O)CCCCCn1sccc1=O |
| InChI | InChI=1S/C10H15NO3S/c1-14-10(13)5-3-2-4-7-11-9(12)6-8-15-11/h6,8H,2-5,7H2,1H3 |
| InChIKey | KYUDBJQSLGNBLW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate?
The IUPAC name of methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate (CID 44564469) is methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate.
What is the SMILES notation for methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate?
The canonical SMILES for methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate is COC(=O)CCCCCn1sccc1=O.
What is the InChIKey of methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate?
The InChIKey is KYUDBJQSLGNBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-14-10(13)5-3-2-4-7-11-9(12)6-8-15-11/h6,8H,2-5,7H2,1H3.
What are the key properties of methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate?
methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate has a molecular weight of 229.30 g/mol, XLogP of 1.64, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3-oxo-1,2-thiazol-2-yl)hexanoate is sourced from PubChem (CID 44564469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).