About N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine
N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine (PubChem CID 44564474) has the molecular formula C9H9N3O3S2
and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine |
| PubChem CID | 44564474 |
| Molecular Formula | C9H9N3O3S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine |
| SMILES | Nc1ncc(S(=O)(=O)c2ccc(NO)cc2)s1 |
| InChI | InChI=1S/C9H9N3O3S2/c10-9-11-5-8(16-9)17(14,15)7-3-1-6(12-13)2-4-7/h1-5,12-13H,(H2,10,11) |
| InChIKey | BNSULIZOGSWZQX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine?
The IUPAC name of N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine (CID 44564474) is N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine.
What is the SMILES notation for N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine?
The canonical SMILES for N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine is Nc1ncc(S(=O)(=O)c2ccc(NO)cc2)s1.
What is the InChIKey of N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine?
The InChIKey is BNSULIZOGSWZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3S2/c10-9-11-5-8(16-9)17(14,15)7-3-1-6(12-13)2-4-7/h1-5,12-13H,(H2,10,11).
What are the key properties of N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine?
N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine has a molecular weight of 271.32 g/mol, XLogP of 1.36, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2-amino-1,3-thiazol-5-yl)sulfonyl]phenyl]hydroxylamine is sourced from PubChem (CID 44564474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).