C21H30O7 — CID 44564519
(Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(2S)-2-hydroxy-3-phenoxypropoxy]cyclopentyl]hept-5-enoic acid (PubChem CID 44564519) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(2S)-2-hydroxy-3-phenoxypropoxy]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(2S)-2-hydroxy-3-phenoxypropoxy]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 44564519 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(2S)-2-hydroxy-3-phenoxypropoxy]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](OC[C@H](O)COc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C21H30O7/c22-15(13-27-16-8-4-3-5-9-16)14-28-21-17(18(23)12-19(21)24)10-6-1-2-7-11-20(25)26/h1,3-6,8-9,15,17-19,21-24H,2,7,10-14H2,(H,25,26)/b6-1-/t15-,17+,18+,19-,21-/m1/s1 |
| InChIKey | HYMKBRFXEHNVOK-XKRIOCRBSA-N |
| XLogP | 1.75 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|