C22H40O5 — CID 44564522
(E,2S,3S)-6-[(2R,3S,6R,8R,10S)-2-[(2S)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,4-dimethylhex-4-ene-1,3-diol (PubChem CID 44564522) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is (E,2S,3S)-6-[(2R,3S,6R,8R,10S)-2-[(2S)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,4-dimethylhex-4-ene-1,3-diol.
| Compound Name | (E,2S,3S)-6-[(2R,3S,6R,8R,10S)-2-[(2S)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,4-dimethylhex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 44564522 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (E,2S,3S)-6-[(2R,3S,6R,8R,10S)-2-[(2S)-butan-2-yl]-10-hydroxy-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]-2,4-dimethylhex-4-ene-1,3-diol |
| SMILES | CC[C@H](C)[C@H]1O[C@]2(CC[C@@H]1C)C[C@@H](O)C[C@@H](C/C=C(\C)[C@@H](O)[C@@H](C)CO)O2 |
| InChI | InChI=1S/C22H40O5/c1-6-14(2)21-16(4)9-10-22(27-21)12-18(24)11-19(26-22)8-7-15(3)20(25)17(5)13-23/h7,14,16-21,23-25H,6,8-13H2,1-5H3/b15-7+/t14-,16-,17-,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | KHMIKNKXBXQODQ-LITABXFQSA-N |
| XLogP | 3.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|