C25H25ClFN5O2 — CID 44564527
N-[4-[(3-chloro-4-fluorophenyl)methyl]-7-[(E)-4-morpholin-4-ylbut-1-enyl]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide (PubChem CID 44564527) has the molecular formula C25H25ClFN5O2 and a molecular weight of 481.96 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-fluorophenyl)methyl]-7-[(E)-4-morpholin-4-ylbut-1-enyl]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[(3-chloro-4-fluorophenyl)methyl]-7-[(E)-4-morpholin-4-ylbut-1-enyl]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44564527 |
| Molecular Formula | C25H25ClFN5O2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[4-[(3-chloro-4-fluorophenyl)methyl]-7-[(E)-4-morpholin-4-ylbut-1-enyl]pyrido[3,2-d]pyrimidin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2c(Cc3ccc(F)c(Cl)c3)ncnc2cc1/C=C/CCN1CCOCC1 |
| InChI | InChI=1S/C25H25ClFN5O2/c1-2-23(33)30-25-18(5-3-4-8-32-9-11-34-12-10-32)15-22-24(31-25)21(28-16-29-22)14-17-6-7-20(27)19(26)13-17/h2-3,5-7,13,15-16H,1,4,8-12,14H2,(H,30,31,33)/b5-3+ |
| InChIKey | OHGZNBMOOVLHFR-HWKANZROSA-N |
| XLogP | 4.27 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|