About 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one
7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one (PubChem CID 44564568) has the molecular formula C24H18F2N6O2
and a molecular weight of 460.44 g/mol. Its IUPAC name is 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one.
Molecular Properties
| Compound Name | 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one |
| PubChem CID | 44564568 |
| Molecular Formula | C24H18F2N6O2 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one |
| SMILES | COc1cccc(-n2c(=O)n(Cc3c(F)cccc3F)c3cnc(Nc4cccnc4)nc32)c1 |
| InChI | InChI=1S/C24H18F2N6O2/c1-34-17-7-2-6-16(11-17)32-22-21(13-28-23(30-22)29-15-5-4-10-27-12-15)31(24(32)33)14-18-19(25)8-3-9-20(18)26/h2-13H,14H2,1H3,(H,28,29,30) |
| InChIKey | QDPZITDRBFKRTK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one?
The IUPAC name of 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one (CID 44564568) is 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one.
What is the SMILES notation for 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one?
The canonical SMILES for 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one is COc1cccc(-n2c(=O)n(Cc3c(F)cccc3F)c3cnc(Nc4cccnc4)nc32)c1.
What is the InChIKey of 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one?
The InChIKey is QDPZITDRBFKRTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F2N6O2/c1-34-17-7-2-6-16(11-17)32-22-21(13-28-23(30-22)29-15-5-4-10-27-12-15)31(24(32)33)14-18-19(25)8-3-9-20(18)26/h2-13H,14H2,1H3,(H,28,29,30).
What are the key properties of 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one?
7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one has a molecular weight of 460.44 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)-2-(pyridin-3-ylamino)purin-8-one is sourced from PubChem (CID 44564568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).