C21H20FNO2 — CID 44564616
5-[(2-fluorophenyl)methyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid (PubChem CID 44564616) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid.
| Compound Name | 5-[(2-fluorophenyl)methyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 44564616 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c3c(n(Cc4ccccc4F)c12)CCCCC3 |
| InChI | InChI=1S/C21H20FNO2/c22-18-11-5-4-7-14(18)13-23-19-12-3-1-2-8-15(19)16-9-6-10-17(20(16)23)21(24)25/h4-7,9-11H,1-3,8,12-13H2,(H,24,25) |
| InChIKey | CBGPKDONPIIEOO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|