About N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 44564790) has the molecular formula C20H15N5OS
and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 44564790 |
| Molecular Formula | C20H15N5OS |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1cc(Nc2ncnc3[nH]ccc23)ccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H15N5OS/c1-26-16-10-12(24-19-14-8-9-21-18(14)22-11-23-19)6-7-13(16)20-25-15-4-2-3-5-17(15)27-20/h2-11H,1H3,(H2,21,22,23,24) |
| InChIKey | CXJQAZDGOBZGLJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 44564790) is N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is COc1cc(Nc2ncnc3[nH]ccc23)ccc1-c1nc2ccccc2s1.
What is the InChIKey of N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is CXJQAZDGOBZGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5OS/c1-26-16-10-12(24-19-14-8-9-21-18(14)22-11-23-19)6-7-13(16)20-25-15-4-2-3-5-17(15)27-20/h2-11H,1H3,(H2,21,22,23,24).
What are the key properties of N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 373.44 g/mol, XLogP of 4.99, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1,3-benzothiazol-2-yl)-3-methoxyphenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 44564790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).