C25H29NO8 — CID 44564797
(5S,8S,9R)-8-benzoyl-2-[(4S,5R)-5-[(Z)-but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 44564797) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is (5S,8S,9R)-8-benzoyl-2-[(4S,5R)-5-[(Z)-but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8S,9R)-8-benzoyl-2-[(4S,5R)-5-[(Z)-but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 44564797 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (5S,8S,9R)-8-benzoyl-2-[(4S,5R)-5-[(Z)-but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC/C=C\[C@H]1OC(C)(C)O[C@@H]1C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C25H29NO8/c1-6-7-13-16-18(33-23(3,4)32-16)17-14(2)19(27)24(34-17)21(29)25(31-5,26-22(24)30)20(28)15-11-9-8-10-12-15/h7-13,16,18,21,29H,6H2,1-5H3,(H,26,30)/b13-7-/t16-,18+,21-,24-,25-/m1/s1 |
| InChIKey | GKHDLOFTWAFRJZ-RFJDXIPJSA-N |
| XLogP | 1.80 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|