About 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one
3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one (PubChem CID 44564814) has the molecular formula C29H34N4O3
and a molecular weight of 486.62 g/mol. Its IUPAC name is 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one |
| PubChem CID | 44564814 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one |
| SMILES | CN(CCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O3/c1-30(18-16-28(24-8-4-2-5-9-24)25-10-6-3-7-11-25)19-17-29(34)32-22-20-31(21-23-32)26-12-14-27(15-13-26)33(35)36/h2-15,28H,16-23H2,1H3 |
| InChIKey | ZKSPWTXSXSXFPO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one?
The IUPAC name of 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one (CID 44564814) is 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one.
What is the SMILES notation for 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one?
The canonical SMILES for 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one is CN(CCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)CCC(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one?
The InChIKey is ZKSPWTXSXSXFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34N4O3/c1-30(18-16-28(24-8-4-2-5-9-24)25-10-6-3-7-11-25)19-17-29(34)32-22-20-31(21-23-32)26-12-14-27(15-13-26)33(35)36/h2-15,28H,16-23H2,1H3.
What are the key properties of 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one?
3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one has a molecular weight of 486.62 g/mol, XLogP of 4.79, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-diphenylpropyl(methyl)amino]-1-[4-(4-nitrophenyl)piperazin-1-yl]propan-1-one is sourced from PubChem (CID 44564814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).