About 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide
4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide (PubChem CID 44564914) has the molecular formula C22H27N3O3
and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide.
Molecular Properties
| Compound Name | 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide |
| PubChem CID | 44564914 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(C(=O)Nc3ccc(O)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-22(2,3)21(28)25-14-12-24(13-15-25)18-8-4-16(5-9-18)20(27)23-17-6-10-19(26)11-7-17/h4-11,26H,12-15H2,1-3H3,(H,23,27) |
| InChIKey | NREMXUJFDHNRPQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide?
The IUPAC name of 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide (CID 44564914) is 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide.
What is the SMILES notation for 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide?
The canonical SMILES for 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide is CC(C)(C)C(=O)N1CCN(c2ccc(C(=O)Nc3ccc(O)cc3)cc2)CC1.
What is the InChIKey of 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide?
The InChIKey is NREMXUJFDHNRPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O3/c1-22(2,3)21(28)25-14-12-24(13-15-25)18-8-4-16(5-9-18)20(27)23-17-6-10-19(26)11-7-17/h4-11,26H,12-15H2,1-3H3,(H,23,27).
What are the key properties of 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide?
4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide has a molecular weight of 381.48 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]-N-(4-hydroxyphenyl)benzamide is sourced from PubChem (CID 44564914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).