C22H20FN5O2 — CID 44564926
2-(cyclopropylamino)-9-(3-fluorophenyl)-7-[(2-methoxyphenyl)methyl]purin-8-one (PubChem CID 44564926) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-(cyclopropylamino)-9-(3-fluorophenyl)-7-[(2-methoxyphenyl)methyl]purin-8-one.
| Compound Name | 2-(cyclopropylamino)-9-(3-fluorophenyl)-7-[(2-methoxyphenyl)methyl]purin-8-one |
|---|---|
| PubChem CID | 44564926 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-(cyclopropylamino)-9-(3-fluorophenyl)-7-[(2-methoxyphenyl)methyl]purin-8-one |
| SMILES | COc1ccccc1Cn1c(=O)n(-c2cccc(F)c2)c2nc(NC3CC3)ncc21 |
| InChI | InChI=1S/C22H20FN5O2/c1-30-19-8-3-2-5-14(19)13-27-18-12-24-21(25-16-9-10-16)26-20(18)28(22(27)29)17-7-4-6-15(23)11-17/h2-8,11-12,16H,9-10,13H2,1H3,(H,24,25,26) |
| InChIKey | QKENJSZXIDEZOZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |