C19H17NO7 — CID 44564970
(E)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enal (PubChem CID 44564970) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is (E)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enal.
| Compound Name | (E)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 44564970 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (E)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enal |
| SMILES | CO[C@@]1(C(=O)c2ccccc2)NC(=O)[C@]2(OC(/C=C/C=O)=C(C)C2=O)[C@H]1O |
| InChI | InChI=1S/C19H17NO7/c1-11-13(9-6-10-21)27-18(14(11)22)16(24)19(26-2,20-17(18)25)15(23)12-7-4-3-5-8-12/h3-10,16,24H,1-2H3,(H,20,25)/b9-6+/t16-,18-,19-/m1/s1 |
| InChIKey | ZMDFBVNQZRCJKR-XENMDSHASA-N |
| XLogP | 0.07 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|