C21H21NO8 — CID 44564973
ethyl (Z)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enoate (PubChem CID 44564973) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is ethyl (Z)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 44564973 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | ethyl (Z)-3-[(5S,8S,9R)-8-benzoyl-9-hydroxy-8-methoxy-3-methyl-4,6-dioxo-1-oxa-7-azaspiro[4.4]non-2-en-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C21H21NO8/c1-4-29-15(23)11-10-14-12(2)16(24)20(30-14)18(26)21(28-3,22-19(20)27)17(25)13-8-6-5-7-9-13/h5-11,18,26H,4H2,1-3H3,(H,22,27)/b11-10-/t18-,20-,21-/m1/s1 |
| InChIKey | XBGGCXWZTPGSQL-VOYSELEVSA-N |
| XLogP | 0.43 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|