About (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine
(2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine (PubChem CID 44564977) has the molecular formula C20H25F2N3O2S
and a molecular weight of 409.50 g/mol. Its IUPAC name is (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine.
Molecular Properties
| Compound Name | (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine |
| PubChem CID | 44564977 |
| Molecular Formula | C20H25F2N3O2S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine |
| SMILES | C[C@@H]1CN(CCc2ccncc2)CCN1S(=O)(=O)c1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C20H25F2N3O2S/c1-16-15-24(12-9-17-7-10-23-11-8-17)13-14-25(16)28(26,27)19-5-3-18(4-6-19)20(2,21)22/h3-8,10-11,16H,9,12-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | ZVBJVIARCWYLQU-MRXNPFEDSA-N |
| XLogP | 3.13 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine?
The IUPAC name of (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine (CID 44564977) is (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine.
What is the SMILES notation for (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine?
The canonical SMILES for (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine is C[C@@H]1CN(CCc2ccncc2)CCN1S(=O)(=O)c1ccc(C(C)(F)F)cc1.
What is the InChIKey of (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine?
The InChIKey is ZVBJVIARCWYLQU-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H25F2N3O2S/c1-16-15-24(12-9-17-7-10-23-11-8-17)13-14-25(16)28(26,27)19-5-3-18(4-6-19)20(2,21)22/h3-8,10-11,16H,9,12-15H2,1-2H3/t16-/m1/s1.
What are the key properties of (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine?
(2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine has a molecular weight of 409.50 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[4-(1,1-difluoroethyl)phenyl]sulfonyl-2-methyl-4-(2-pyridin-4-ylethyl)piperazine is sourced from PubChem (CID 44564977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).