C21H26N2O6 — CID 44565026
(5S,8S,9R)-8-benzoyl-2-(butylaminomethyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 44565026) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is (5S,8S,9R)-8-benzoyl-2-(butylaminomethyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8S,9R)-8-benzoyl-2-(butylaminomethyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 44565026 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (5S,8S,9R)-8-benzoyl-2-(butylaminomethyl)-9-hydroxy-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CCCCNCC1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C21H26N2O6/c1-4-5-11-22-12-15-13(2)16(24)20(29-15)18(26)21(28-3,23-19(20)27)17(25)14-9-7-6-8-10-14/h6-10,18,22,26H,4-5,11-12H2,1-3H3,(H,23,27)/t18-,20-,21-/m1/s1 |
| InChIKey | OZBSMADPDOBZJZ-HMXCVIKNSA-N |
| XLogP | 0.70 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|