C23H22FN5O3 — CID 44565032
2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-(3-methoxyphenyl)purin-8-one (PubChem CID 44565032) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is 2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-(3-methoxyphenyl)purin-8-one.
| Compound Name | 2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-(3-methoxyphenyl)purin-8-one |
|---|---|
| PubChem CID | 44565032 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-(cyclopropylamino)-7-[(2-fluoro-6-methoxyphenyl)methyl]-9-(3-methoxyphenyl)purin-8-one |
| SMILES | COc1cccc(-n2c(=O)n(Cc3c(F)cccc3OC)c3cnc(NC4CC4)nc32)c1 |
| InChI | InChI=1S/C23H22FN5O3/c1-31-16-6-3-5-15(11-16)29-21-19(12-25-22(27-21)26-14-9-10-14)28(23(29)30)13-17-18(24)7-4-8-20(17)32-2/h3-8,11-12,14H,9-10,13H2,1-2H3,(H,25,26,27) |
| InChIKey | QCPZDWSHEPNHDV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |