C13H14F2N4O5S — CID 44565056
N-(diaminomethylidene)-2-(3,5-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxamide;methanesulfonic acid (PubChem CID 44565056) has the molecular formula C13H14F2N4O5S and a molecular weight of 376.34 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(3,5-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxamide;methanesulfonic acid.
| Compound Name | N-(diaminomethylidene)-2-(3,5-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 44565056 |
| Molecular Formula | C13H14F2N4O5S |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-(diaminomethylidene)-2-(3,5-difluorophenyl)-5-methyl-1,3-oxazole-4-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1oc(-c2cc(F)cc(F)c2)nc1C(=O)N=C(N)N |
| InChI | InChI=1S/C12H10F2N4O2.CH4O3S/c1-5-9(10(19)18-12(15)16)17-11(20-5)6-2-7(13)4-8(14)3-6;1-5(2,3)4/h2-4H,1H3,(H4,15,16,18,19);1H3,(H,2,3,4) |
| InChIKey | NHURPOGAIDADSW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 161.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|