C21H19F2N5O2 — CID 44565078
7-[(2,6-difluorophenyl)methyl]-2-(ethylamino)-9-(3-methoxyphenyl)purin-8-one (PubChem CID 44565078) has the molecular formula C21H19F2N5O2 and a molecular weight of 411.41 g/mol. Its IUPAC name is 7-[(2,6-difluorophenyl)methyl]-2-(ethylamino)-9-(3-methoxyphenyl)purin-8-one.
| Compound Name | 7-[(2,6-difluorophenyl)methyl]-2-(ethylamino)-9-(3-methoxyphenyl)purin-8-one |
|---|---|
| PubChem CID | 44565078 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 7-[(2,6-difluorophenyl)methyl]-2-(ethylamino)-9-(3-methoxyphenyl)purin-8-one |
| SMILES | CCNc1ncc2c(n1)n(-c1cccc(OC)c1)c(=O)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C21H19F2N5O2/c1-3-24-20-25-11-18-19(26-20)28(13-6-4-7-14(10-13)30-2)21(29)27(18)12-15-16(22)8-5-9-17(15)23/h4-11H,3,12H2,1-2H3,(H,24,25,26) |
| InChIKey | GBWIHBQNJASNMP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |