C19H15ClF3N3O5 — CID 44565098
3-[[2-[[(1S)-1-(5-chlorofuran-2-yl)-2,2,2-trifluoroethyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 44565098) has the molecular formula C19H15ClF3N3O5 and a molecular weight of 457.79 g/mol. Its IUPAC name is 3-[[2-[[(1S)-1-(5-chlorofuran-2-yl)-2,2,2-trifluoroethyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[(1S)-1-(5-chlorofuran-2-yl)-2,2,2-trifluoroethyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 44565098 |
| Molecular Formula | C19H15ClF3N3O5 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 3-[[2-[[(1S)-1-(5-chlorofuran-2-yl)-2,2,2-trifluoroethyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2c(N[C@@H](c3ccc(Cl)o3)C(F)(F)F)c(=O)c2=O)c1O |
| InChI | InChI=1S/C19H15ClF3N3O5/c1-26(2)18(30)8-4-3-5-9(14(8)27)24-12-13(16(29)15(12)28)25-17(19(21,22)23)10-6-7-11(20)31-10/h3-7,17,24-25,27H,1-2H3/t17-/m0/s1 |
| InChIKey | XDIAMTWURDXGAQ-KRWDZBQOSA-N |
| XLogP | 3.40 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|