About 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one
2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one (PubChem CID 44565133) has the molecular formula C26H21F2N5O2
and a molecular weight of 473.48 g/mol. Its IUPAC name is 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one.
Molecular Properties
| Compound Name | 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one |
| PubChem CID | 44565133 |
| Molecular Formula | C26H21F2N5O2 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one |
| SMILES | COc1cccc(-n2c(=O)n(Cc3c(F)cccc3F)c3cnc(NCc4ccccc4)nc32)c1 |
| InChI | InChI=1S/C26H21F2N5O2/c1-35-19-10-5-9-18(13-19)33-24-23(15-30-25(31-24)29-14-17-7-3-2-4-8-17)32(26(33)34)16-20-21(27)11-6-12-22(20)28/h2-13,15H,14,16H2,1H3,(H,29,30,31) |
| InChIKey | NPLCYSYGICENHP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one?
The IUPAC name of 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one (CID 44565133) is 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one.
What is the SMILES notation for 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one?
The canonical SMILES for 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one is COc1cccc(-n2c(=O)n(Cc3c(F)cccc3F)c3cnc(NCc4ccccc4)nc32)c1.
What is the InChIKey of 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one?
The InChIKey is NPLCYSYGICENHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21F2N5O2/c1-35-19-10-5-9-18(13-19)33-24-23(15-30-25(31-24)29-14-17-7-3-2-4-8-17)32(26(33)34)16-20-21(27)11-6-12-22(20)28/h2-13,15H,14,16H2,1H3,(H,29,30,31).
What are the key properties of 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one?
2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one has a molecular weight of 473.48 g/mol, XLogP of 4.53, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)-7-[(2,6-difluorophenyl)methyl]-9-(3-methoxyphenyl)purin-8-one is sourced from PubChem (CID 44565133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).