C23H36O3 — CID 44565173
ethyl (1R,4aS,4bS,7S,8aR,10aS)-8a-ethenyl-7-formyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 44565173) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is ethyl (1R,4aS,4bS,7S,8aR,10aS)-8a-ethenyl-7-formyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | ethyl (1R,4aS,4bS,7S,8aR,10aS)-8a-ethenyl-7-formyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 44565173 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | ethyl (1R,4aS,4bS,7S,8aR,10aS)-8a-ethenyl-7-formyl-1,4a,7-trimethyl-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | C=C[C@]12CC[C@H]3[C@@](C)(CCC[C@@]3(C)C(=O)OCC)[C@@H]1CC[C@](C)(C=O)C2 |
| InChI | InChI=1S/C23H36O3/c1-6-23-14-10-17-21(4,18(23)9-13-20(3,15-23)16-24)11-8-12-22(17,5)19(25)26-7-2/h6,16-18H,1,7-15H2,2-5H3/t17-,18-,20-,21+,22+,23+/m0/s1 |
| InChIKey | OBDBSWKETQIULE-DPVJEZKXSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|