About S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate
S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate (PubChem CID 44565192) has the molecular formula C14H25N3O5S
and a molecular weight of 347.44 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate |
| PubChem CID | 44565192 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate |
| SMILES | CC(=O)NCCSC(=O)CNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O5S/c1-9(17-13(21)22-14(3,4)5)12(20)16-8-11(19)23-7-6-15-10(2)18/h9H,6-8H2,1-5H3,(H,15,18)(H,16,20)(H,17,21)/t9-/m0/s1 |
| InChIKey | AUBYJXSLVPNALW-VIFPVBQESA-N |
| XLogP | 0.41 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate?
The IUPAC name of S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate (CID 44565192) is S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate.
What is the SMILES notation for S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate?
The canonical SMILES for S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate is CC(=O)NCCSC(=O)CNC(=O)[C@H](C)NC(=O)OC(C)(C)C.
What is the InChIKey of S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate?
The InChIKey is AUBYJXSLVPNALW-VIFPVBQESA-N. The full InChI is InChI=1S/C14H25N3O5S/c1-9(17-13(21)22-14(3,4)5)12(20)16-8-11(19)23-7-6-15-10(2)18/h9H,6-8H2,1-5H3,(H,15,18)(H,16,20)(H,17,21)/t9-/m0/s1.
What are the key properties of S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate?
S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate has a molecular weight of 347.44 g/mol, XLogP of 0.41, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) 2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethanethioate is sourced from PubChem (CID 44565192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).