C15H21Cl2N3O4S — CID 44565332
2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-diethylpentanediamide (PubChem CID 44565332) has the molecular formula C15H21Cl2N3O4S and a molecular weight of 410.32 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-diethylpentanediamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-diethylpentanediamide |
|---|---|
| PubChem CID | 44565332 |
| Molecular Formula | C15H21Cl2N3O4S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-diethylpentanediamide |
| SMILES | CCNC(=O)CCC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)NCC |
| InChI | InChI=1S/C15H21Cl2N3O4S/c1-3-18-14(21)8-7-12(15(22)19-4-2)20-25(23,24)13-9-10(16)5-6-11(13)17/h5-6,9,12,20H,3-4,7-8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | PQCFMTVTMKYKPI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |