C17H25Cl2N3O4S — CID 44565333
2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide (PubChem CID 44565333) has the molecular formula C17H25Cl2N3O4S and a molecular weight of 438.38 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide.
| Compound Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide |
|---|---|
| PubChem CID | 44565333 |
| Molecular Formula | C17H25Cl2N3O4S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)sulfonylamino]-N,N'-di(propan-2-yl)pentanediamide |
| SMILES | CC(C)NC(=O)CCC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)NC(C)C |
| InChI | InChI=1S/C17H25Cl2N3O4S/c1-10(2)20-16(23)8-7-14(17(24)21-11(3)4)22-27(25,26)15-9-12(18)5-6-13(15)19/h5-6,9-11,14,22H,7-8H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | WBUPWRCLPHHIKH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |