About (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one
(2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 44565506) has the molecular formula C22H19Cl2NO
and a molecular weight of 384.31 g/mol. Its IUPAC name is (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| PubChem CID | 44565506 |
| Molecular Formula | C22H19Cl2NO |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CN1C2CCC1/C(=C\c1ccc(Cl)cc1)C(=O)/C2=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl2NO/c1-25-20-10-11-21(25)19(13-15-4-8-17(24)9-5-15)22(26)18(20)12-14-2-6-16(23)7-3-14/h2-9,12-13,20-21H,10-11H2,1H3/b18-12+,19-13+ |
| InChIKey | YILQAVVQOZRPNH-KLCVKJMQSA-N |
| XLogP | 5.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
The IUPAC name of (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one (CID 44565506) is (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
The canonical SMILES for (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one is CN1C2CCC1/C(=C\c1ccc(Cl)cc1)C(=O)/C2=C/c1ccc(Cl)cc1.
What is the InChIKey of (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
The InChIKey is YILQAVVQOZRPNH-KLCVKJMQSA-N. The full InChI is InChI=1S/C22H19Cl2NO/c1-25-20-10-11-21(25)19(13-15-4-8-17(24)9-5-15)22(26)18(20)12-14-2-6-16(23)7-3-14/h2-9,12-13,20-21H,10-11H2,1H3/b18-12+,19-13+.
What are the key properties of (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one?
(2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one has a molecular weight of 384.31 g/mol, XLogP of 5.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-2,4-bis[(4-chlorophenyl)methylidene]-8-methyl-8-azabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 44565506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).