About (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one
(3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (PubChem CID 44565548) has the molecular formula C13H17IO4
and a molecular weight of 364.18 g/mol. Its IUPAC name is (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
Molecular Properties
| Compound Name | (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| PubChem CID | 44565548 |
| Molecular Formula | C13H17IO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one |
| SMILES | O=C1C2C=C(I)C(CC2OCCCCO)[C@]12CO2 |
| InChI | InChI=1S/C13H17IO4/c14-10-5-8-11(17-4-2-1-3-15)6-9(10)13(7-18-13)12(8)16/h5,8-9,11,15H,1-4,6-7H2/t8?,9?,11?,13-/m1/s1 |
| InChIKey | XSHRZDCLRVNXBY-ZJYAODSZSA-N |
| XLogP | 1.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
The IUPAC name of (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one (CID 44565548) is (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one.
What is the SMILES notation for (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
The canonical SMILES for (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one is O=C1C2C=C(I)C(CC2OCCCCO)[C@]12CO2.
What is the InChIKey of (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
The InChIKey is XSHRZDCLRVNXBY-ZJYAODSZSA-N. The full InChI is InChI=1S/C13H17IO4/c14-10-5-8-11(17-4-2-1-3-15)6-9(10)13(7-18-13)12(8)16/h5,8-9,11,15H,1-4,6-7H2/t8?,9?,11?,13-/m1/s1.
What are the key properties of (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one?
(3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one has a molecular weight of 364.18 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-(4-hydroxybutoxy)-5-iodospiro[bicyclo[2.2.2]oct-5-ene-3,2'-oxirane]-2-one is sourced from PubChem (CID 44565548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).