C24H26N6O3 — CID 44565569
2-[2-[4-[4-amino-5-(3-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenoxy]ethylamino]-N-methylacetamide (PubChem CID 44565569) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[2-[4-[4-amino-5-(3-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenoxy]ethylamino]-N-methylacetamide.
| Compound Name | 2-[2-[4-[4-amino-5-(3-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenoxy]ethylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 44565569 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 2-[2-[4-[4-amino-5-(3-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenoxy]ethylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNCCOc1ccc(-n2cc(-c3cccc(OC)c3)c3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C24H26N6O3/c1-26-21(31)13-27-10-11-33-18-8-6-17(7-9-18)30-14-20(16-4-3-5-19(12-16)32-2)22-23(25)28-15-29-24(22)30/h3-9,12,14-15,27H,10-11,13H2,1-2H3,(H,26,31)(H2,25,28,29) |
| InChIKey | SSJLKPMRPVKRDP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|