C17H22F4N6O — CID 44565583
[(2S,4S)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidin-2-yl]-(3,3,4,4-tetrafluoropyrrolidin-1-yl)methanone (PubChem CID 44565583) has the molecular formula C17H22F4N6O and a molecular weight of 402.40 g/mol. Its IUPAC name is [(2S,4S)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidin-2-yl]-(3,3,4,4-tetrafluoropyrrolidin-1-yl)methanone.
| Compound Name | [(2S,4S)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidin-2-yl]-(3,3,4,4-tetrafluoropyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 44565583 |
| Molecular Formula | C17H22F4N6O |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [(2S,4S)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrolidin-2-yl]-(3,3,4,4-tetrafluoropyrrolidin-1-yl)methanone |
| SMILES | O=C([C@@H]1C[C@H](N2CCN(c3ncccn3)CC2)CN1)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C17H22F4N6O/c18-16(19)10-27(11-17(16,20)21)14(28)13-8-12(9-24-13)25-4-6-26(7-5-25)15-22-2-1-3-23-15/h1-3,12-13,24H,4-11H2/t12-,13-/m0/s1 |
| InChIKey | CKWFAXHAVMYEEF-STQMWFEESA-N |
| XLogP | 0.44 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|