C24H24ClN5O2 — CID 44565624
N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-ethylbenzamide (PubChem CID 44565624) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-ethylbenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-ethylbenzamide |
|---|---|
| PubChem CID | 44565624 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(N,N-dimethylcarbamimidoyl)benzoyl]amino]-5-ethylbenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(CC)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C24H24ClN5O2/c1-4-15-5-11-20(19(13-15)24(32)29-21-12-10-18(25)14-27-21)28-23(31)17-8-6-16(7-9-17)22(26)30(2)3/h5-14,26H,4H2,1-3H3,(H,28,31)(H,27,29,32)/b26-22- |
| InChIKey | OKHFEZCWSGLUKP-ROMGYVFFSA-N |
| XLogP | 4.69 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|